About N,N-dimethylacetamide;bis(N-methyl-N-propylacetamide)
N,N-dimethylacetamide;bis(N-methyl-N-propylacetamide) (PubChem CID 54129465) has the molecular formula C16H35N3O3
and a molecular weight of 317.47 g/mol. Its IUPAC name is N,N-dimethylacetamide;bis(N-methyl-N-propylacetamide).
Molecular Properties
| Compound Name | N,N-dimethylacetamide;bis(N-methyl-N-propylacetamide) |
| PubChem CID | 54129465 |
| Molecular Formula | C16H35N3O3 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.27 |
| IUPAC Name | N,N-dimethylacetamide;bis(N-methyl-N-propylacetamide) |
| SMILES | CC(=O)N(C)C.CCCN(C)C(C)=O.CCCN(C)C(C)=O |
| InChI | InChI=1S/2C6H13NO.C4H9NO/c2*1-4-5-7(3)6(2)8;1-4(6)5(2)3/h2*4-5H2,1-3H3;1-3H3 |
| InChIKey | NTHWSBBLUGOQEH-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N-dimethylacetamide;bis(N-methyl-N-propylacetamide) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylacetamide;bis(N-methyl-N-propylacetamide)?
The IUPAC name of N,N-dimethylacetamide;bis(N-methyl-N-propylacetamide) (CID 54129465) is N,N-dimethylacetamide;bis(N-methyl-N-propylacetamide).
What is the SMILES notation for N,N-dimethylacetamide;bis(N-methyl-N-propylacetamide)?
The canonical SMILES for N,N-dimethylacetamide;bis(N-methyl-N-propylacetamide) is CC(=O)N(C)C.CCCN(C)C(C)=O.CCCN(C)C(C)=O.
What is the InChIKey of N,N-dimethylacetamide;bis(N-methyl-N-propylacetamide)?
The InChIKey is NTHWSBBLUGOQEH-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H13NO.C4H9NO/c2*1-4-5-7(3)6(2)8;1-4(6)5(2)3/h2*4-5H2,1-3H3;1-3H3.
What are the key properties of N,N-dimethylacetamide;bis(N-methyl-N-propylacetamide)?
N,N-dimethylacetamide;bis(N-methyl-N-propylacetamide) has a molecular weight of 317.47 g/mol, XLogP of 1.84, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylacetamide;bis(N-methyl-N-propylacetamide) is sourced from PubChem (CID 54129465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).