C18H29N3O4 — CID 54132038
1-(1-acetylpiperidin-4-yl)-3-(2-morpholin-4-yl-2-oxoethyl)piperidin-2-one (PubChem CID 54132038) has the molecular formula C18H29N3O4 and a molecular weight of 351.45 g/mol. Its IUPAC name is 1-(1-acetylpiperidin-4-yl)-3-(2-morpholin-4-yl-2-oxoethyl)piperidin-2-one.
| Compound Name | 1-(1-acetylpiperidin-4-yl)-3-(2-morpholin-4-yl-2-oxoethyl)piperidin-2-one |
|---|---|
| PubChem CID | 54132038 |
| Molecular Formula | C18H29N3O4 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | 1-(1-acetylpiperidin-4-yl)-3-(2-morpholin-4-yl-2-oxoethyl)piperidin-2-one |
| SMILES | CC(=O)N1CCC(N2CCCC(CC(=O)N3CCOCC3)C2=O)CC1 |
| InChI | InChI=1S/C18H29N3O4/c1-14(22)19-7-4-16(5-8-19)21-6-2-3-15(18(21)24)13-17(23)20-9-11-25-12-10-20/h15-16H,2-13H2,1H3 |
| InChIKey | NVAXXVAOCBLNGG-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |