C9H17NO — CID 54132332
N,1-diethyl-2-methylcyclopropane-1-carboxamide (PubChem CID 54132332) has the molecular formula C9H17NO and a molecular weight of 155.24 g/mol. Its IUPAC name is N,1-diethyl-2-methylcyclopropane-1-carboxamide.
| Compound Name | N,1-diethyl-2-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 54132332 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | N,1-diethyl-2-methylcyclopropane-1-carboxamide |
| SMILES | CCNC(=O)C1(CC)CC1C |
| InChI | InChI=1S/C9H17NO/c1-4-9(6-7(9)3)8(11)10-5-2/h7H,4-6H2,1-3H3,(H,10,11) |
| InChIKey | NVFRVHMZGBPJED-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |