C9H10N2O3 — CID 54133355
2-methyl-6-oxo-1-prop-2-enylpyrimidine-4-carboxylic acid (PubChem CID 54133355) has the molecular formula C9H10N2O3 and a molecular weight of 194.19 g/mol. Its IUPAC name is 2-methyl-6-oxo-1-prop-2-enylpyrimidine-4-carboxylic acid.
| Compound Name | 2-methyl-6-oxo-1-prop-2-enylpyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 54133355 |
| Molecular Formula | C9H10N2O3 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | 2-methyl-6-oxo-1-prop-2-enylpyrimidine-4-carboxylic acid |
| SMILES | C=CCn1c(C)nc(C(=O)O)cc1=O |
| InChI | InChI=1S/C9H10N2O3/c1-3-4-11-6(2)10-7(9(13)14)5-8(11)12/h3,5H,1,4H2,2H3,(H,13,14) |
| InChIKey | NVXOGYUVDTXABZ-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|