C16H31IOSi — CID 54134550
(1-iodo-4-prop-2-enyldec-1-en-4-yl)oxy-trimethylsilane (PubChem CID 54134550) has the molecular formula C16H31IOSi and a molecular weight of 394.41 g/mol. Its IUPAC name is (1-iodo-4-prop-2-enyldec-1-en-4-yl)oxy-trimethylsilane.
| Compound Name | (1-iodo-4-prop-2-enyldec-1-en-4-yl)oxy-trimethylsilane |
|---|---|
| PubChem CID | 54134550 |
| Molecular Formula | C16H31IOSi |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | (1-iodo-4-prop-2-enyldec-1-en-4-yl)oxy-trimethylsilane |
| SMILES | C=CCC(CC=CI)(CCCCCC)O[Si](C)(C)C |
| InChI | InChI=1S/C16H31IOSi/c1-6-8-9-10-13-16(12-7-2,14-11-15-17)18-19(3,4)5/h7,11,15H,2,6,8-10,12-14H2,1,3-5H3 |
| InChIKey | NWTDDEXLNWXLOM-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|