C26H26FNO5 — CID 54136479
methyl (3R)-7-[4-(4-fluorophenyl)-1-oxo-2-propan-2-ylisoquinolin-3-yl]-3-hydroxy-5-oxohept-6-enoate (PubChem CID 54136479) has the molecular formula C26H26FNO5 and a molecular weight of 451.49 g/mol. Its IUPAC name is methyl (3R)-7-[4-(4-fluorophenyl)-1-oxo-2-propan-2-ylisoquinolin-3-yl]-3-hydroxy-5-oxohept-6-enoate.
| Compound Name | methyl (3R)-7-[4-(4-fluorophenyl)-1-oxo-2-propan-2-ylisoquinolin-3-yl]-3-hydroxy-5-oxohept-6-enoate |
|---|---|
| PubChem CID | 54136479 |
| Molecular Formula | C26H26FNO5 |
| Molecular Weight | 451.49 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | methyl (3R)-7-[4-(4-fluorophenyl)-1-oxo-2-propan-2-ylisoquinolin-3-yl]-3-hydroxy-5-oxohept-6-enoate |
| SMILES | COC(=O)C[C@H](O)CC(=O)C=Cc1c(-c2ccc(F)cc2)c2ccccc2c(=O)n1C(C)C |
| InChI | InChI=1S/C26H26FNO5/c1-16(2)28-23(13-12-19(29)14-20(30)15-24(31)33-3)25(17-8-10-18(27)11-9-17)21-6-4-5-7-22(21)26(28)32/h4-13,16,20,30H,14-15H2,1-3H3/t20-/m1/s1 |
| InChIKey | NYBHMFIYDSUSQF-HXUWFJFHSA-N |
| XLogP | 4.28 |
| TPSA | 85.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.49 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|