C29H33NO4 — CID 54137106
5-methoxy-4-pentoxy-2-[2-(4-phenylmethoxyphenyl)ethyl]isoindol-1-ol (PubChem CID 54137106) has the molecular formula C29H33NO4 and a molecular weight of 459.59 g/mol. Its IUPAC name is 5-methoxy-4-pentoxy-2-[2-(4-phenylmethoxyphenyl)ethyl]isoindol-1-ol.
| Compound Name | 5-methoxy-4-pentoxy-2-[2-(4-phenylmethoxyphenyl)ethyl]isoindol-1-ol |
|---|---|
| PubChem CID | 54137106 |
| Molecular Formula | C29H33NO4 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | 5-methoxy-4-pentoxy-2-[2-(4-phenylmethoxyphenyl)ethyl]isoindol-1-ol |
| SMILES | CCCCCOc1c(OC)ccc2c(O)n(CCc3ccc(OCc4ccccc4)cc3)cc12 |
| InChI | InChI=1S/C29H33NO4/c1-3-4-8-19-33-28-26-20-30(29(31)25(26)15-16-27(28)32-2)18-17-22-11-13-24(14-12-22)34-21-23-9-6-5-7-10-23/h5-7,9-16,20,31H,3-4,8,17-19,21H2,1-2H3 |
| InChIKey | NYMQFNLCEKVLJZ-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 52.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|