C21H21F2N5O5S — CID 54137782
[2-[4-[2,6-difluoro-4-[(5S)-2-oxo-5-[(1,2,5-thiadiazol-3-ylamino)methyl]-1,3-oxazolidin-3-yl]phenyl]-3,6-dihydro-2H-pyridin-1-yl]-2-oxoethyl] acetate (PubChem CID 54137782) has the molecular formula C21H21F2N5O5S and a molecular weight of 493.49 g/mol. Its IUPAC name is [2-[4-[2,6-difluoro-4-[(5S)-2-oxo-5-[(1,2,5-thiadiazol-3-ylamino)methyl]-1,3-oxazolidin-3-yl]phenyl]-3,6-dihydro-2H-pyridin-1-yl]-2-oxoethyl] acetate.
| Compound Name | [2-[4-[2,6-difluoro-4-[(5S)-2-oxo-5-[(1,2,5-thiadiazol-3-ylamino)methyl]-1,3-oxazolidin-3-yl]phenyl]-3,6-dihydro-2H-pyridin-1-yl]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 54137782 |
| Molecular Formula | C21H21F2N5O5S |
| Molecular Weight | 493.49 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | [2-[4-[2,6-difluoro-4-[(5S)-2-oxo-5-[(1,2,5-thiadiazol-3-ylamino)methyl]-1,3-oxazolidin-3-yl]phenyl]-3,6-dihydro-2H-pyridin-1-yl]-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)N1CC=C(c2c(F)cc(N3C[C@H](CNc4cnsn4)OC3=O)cc2F)CC1 |
| InChI | InChI=1S/C21H21F2N5O5S/c1-12(29)32-11-19(30)27-4-2-13(3-5-27)20-16(22)6-14(7-17(20)23)28-10-15(33-21(28)31)8-24-18-9-25-34-26-18/h2,6-7,9,15H,3-5,8,10-11H2,1H3,(H,24,26)/t15-/m0/s1 |
| InChIKey | NYXSLQKLFAONGJ-HNNXBMFYSA-N |
| XLogP | 2.43 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.49 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |