C18H23O5P — CID 54137988
[2-(2-ethoxyethoxy)-1,1-diphenylethyl] dihydrogen phosphite (PubChem CID 54137988) has the molecular formula C18H23O5P and a molecular weight of 350.35 g/mol. Its IUPAC name is [2-(2-ethoxyethoxy)-1,1-diphenylethyl] dihydrogen phosphite.
| Compound Name | [2-(2-ethoxyethoxy)-1,1-diphenylethyl] dihydrogen phosphite |
|---|---|
| PubChem CID | 54137988 |
| Molecular Formula | C18H23O5P |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | [2-(2-ethoxyethoxy)-1,1-diphenylethyl] dihydrogen phosphite |
| SMILES | CCOCCOCC(OP(O)O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H23O5P/c1-2-21-13-14-22-15-18(23-24(19)20,16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-12,19-20H,2,13-15H2,1H3 |
| InChIKey | NZBORHXWVTWDCT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|