C25H26N6O — CID 54139818
5-[(6-methyl-3-pyridinyl)methyl]-2-[3-(N-pyridin-2-ylanilino)propylamino]-1H-pyrimidin-6-one (PubChem CID 54139818) has the molecular formula C25H26N6O and a molecular weight of 426.52 g/mol. Its IUPAC name is 5-[(6-methyl-3-pyridinyl)methyl]-2-[3-(N-pyridin-2-ylanilino)propylamino]-1H-pyrimidin-6-one.
| Compound Name | 5-[(6-methyl-3-pyridinyl)methyl]-2-[3-(N-pyridin-2-ylanilino)propylamino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 54139818 |
| Molecular Formula | C25H26N6O |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 5-[(6-methyl-3-pyridinyl)methyl]-2-[3-(N-pyridin-2-ylanilino)propylamino]-1H-pyrimidin-6-one |
| SMILES | Cc1ccc(Cc2cnc(NCCCN(c3ccccc3)c3ccccn3)[nH]c2=O)cn1 |
| InChI | InChI=1S/C25H26N6O/c1-19-11-12-20(17-28-19)16-21-18-29-25(30-24(21)32)27-14-7-15-31(22-8-3-2-4-9-22)23-10-5-6-13-26-23/h2-6,8-13,17-18H,7,14-16H2,1H3,(H2,27,29,30,32) |
| InChIKey | OAHSPIAEYZHAFI-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|