C18H22N6O — CID 14338593
2-[4-(5-methyl-1H-imidazol-4-yl)butylamino]-5-(pyridin-3-ylmethyl)-1H-pyrimidin-6-one (PubChem CID 14338593) has the molecular formula C18H22N6O and a molecular weight of 338.42 g/mol. Its IUPAC name is 2-[4-(5-methyl-1H-imidazol-4-yl)butylamino]-5-(pyridin-3-ylmethyl)-1H-pyrimidin-6-one.
| Compound Name | 2-[4-(5-methyl-1H-imidazol-4-yl)butylamino]-5-(pyridin-3-ylmethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 14338593 |
| Molecular Formula | C18H22N6O |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | 2-[4-(5-methyl-1H-imidazol-4-yl)butylamino]-5-(pyridin-3-ylmethyl)-1H-pyrimidin-6-one |
| SMILES | Cc1[nH]cnc1CCCCNc1ncc(Cc2cccnc2)c(=O)[nH]1 |
| InChI | InChI=1S/C18H22N6O/c1-13-16(23-12-22-13)6-2-3-8-20-18-21-11-15(17(25)24-18)9-14-5-4-7-19-10-14/h4-5,7,10-12H,2-3,6,8-9H2,1H3,(H,22,23)(H2,20,21,24,25) |
| InChIKey | UNUAXIUUDSLIGI-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|