C18H21NO3 — CID 54140453
3-[cyclopropyl(phenyl)methyl]-1-oxa-8-azaspiro[4.5]decane-2,4-dione (PubChem CID 54140453) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is 3-[cyclopropyl(phenyl)methyl]-1-oxa-8-azaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[cyclopropyl(phenyl)methyl]-1-oxa-8-azaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 54140453 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 3-[cyclopropyl(phenyl)methyl]-1-oxa-8-azaspiro[4.5]decane-2,4-dione |
| SMILES | O=C1OC2(CCNCC2)C(=O)C1C(c1ccccc1)C1CC1 |
| InChI | InChI=1S/C18H21NO3/c20-16-15(17(21)22-18(16)8-10-19-11-9-18)14(13-6-7-13)12-4-2-1-3-5-12/h1-5,13-15,19H,6-11H2 |
| InChIKey | OASJVXXPMFNPKX-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|