C23H29NO5 — CID 54199610
tert-butyl 3-[cyclopropyl(phenyl)methyl]-2,4-dioxo-1-oxa-8-azaspiro[4.5]decane-8-carboxylate (PubChem CID 54199610) has the molecular formula C23H29NO5 and a molecular weight of 399.49 g/mol. Its IUPAC name is tert-butyl 3-[cyclopropyl(phenyl)methyl]-2,4-dioxo-1-oxa-8-azaspiro[4.5]decane-8-carboxylate.
| Compound Name | tert-butyl 3-[cyclopropyl(phenyl)methyl]-2,4-dioxo-1-oxa-8-azaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 54199610 |
| Molecular Formula | C23H29NO5 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | tert-butyl 3-[cyclopropyl(phenyl)methyl]-2,4-dioxo-1-oxa-8-azaspiro[4.5]decane-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)OC(=O)C(C(c1ccccc1)C1CC1)C2=O |
| InChI | InChI=1S/C23H29NO5/c1-22(2,3)29-21(27)24-13-11-23(12-14-24)19(25)18(20(26)28-23)17(16-9-10-16)15-7-5-4-6-8-15/h4-8,16-18H,9-14H2,1-3H3 |
| InChIKey | POHGIKARKPTRBC-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|