About 2-chloro-5-methylbenzene-1,4-dicarbonyl chloride
2-chloro-5-methylbenzene-1,4-dicarbonyl chloride (PubChem CID 54141674) has the molecular formula C9H5Cl3O2
and a molecular weight of 251.50 g/mol. Its IUPAC name is 2-chloro-5-methylbenzene-1,4-dicarbonyl chloride.
Molecular Properties
| Compound Name | 2-chloro-5-methylbenzene-1,4-dicarbonyl chloride |
| PubChem CID | 54141674 |
| Molecular Formula | C9H5Cl3O2 |
| Molecular Weight | 251.50 g/mol |
| Exact Mass | 249.94 |
| IUPAC Name | 2-chloro-5-methylbenzene-1,4-dicarbonyl chloride |
| SMILES | Cc1cc(C(=O)Cl)c(Cl)cc1C(=O)Cl |
| InChI | InChI=1S/C9H5Cl3O2/c1-4-2-6(9(12)14)7(10)3-5(4)8(11)13/h2-3H,1H3 |
| InChIKey | OBNRQWUJZGDADH-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.50 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-5-methylbenzene-1,4-dicarbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-methylbenzene-1,4-dicarbonyl chloride?
The IUPAC name of 2-chloro-5-methylbenzene-1,4-dicarbonyl chloride (CID 54141674) is 2-chloro-5-methylbenzene-1,4-dicarbonyl chloride.
What is the SMILES notation for 2-chloro-5-methylbenzene-1,4-dicarbonyl chloride?
The canonical SMILES for 2-chloro-5-methylbenzene-1,4-dicarbonyl chloride is Cc1cc(C(=O)Cl)c(Cl)cc1C(=O)Cl.
What is the InChIKey of 2-chloro-5-methylbenzene-1,4-dicarbonyl chloride?
The InChIKey is OBNRQWUJZGDADH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5Cl3O2/c1-4-2-6(9(12)14)7(10)3-5(4)8(11)13/h2-3H,1H3.
What are the key properties of 2-chloro-5-methylbenzene-1,4-dicarbonyl chloride?
2-chloro-5-methylbenzene-1,4-dicarbonyl chloride has a molecular weight of 251.50 g/mol, XLogP of 3.41, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-methylbenzene-1,4-dicarbonyl chloride is sourced from PubChem (CID 54141674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).