C25H36N4O3 — CID 54142143
tert-butyl 2-[[(3-cyanophenyl)-cycloheptylcarbamoyl]amino]piperidine-1-carboxylate (PubChem CID 54142143) has the molecular formula C25H36N4O3 and a molecular weight of 440.59 g/mol. Its IUPAC name is tert-butyl 2-[[(3-cyanophenyl)-cycloheptylcarbamoyl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[(3-cyanophenyl)-cycloheptylcarbamoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 54142143 |
| Molecular Formula | C25H36N4O3 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | tert-butyl 2-[[(3-cyanophenyl)-cycloheptylcarbamoyl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1NC(=O)N(c1cccc(C#N)c1)C1CCCCCC1 |
| InChI | InChI=1S/C25H36N4O3/c1-25(2,3)32-24(31)28-16-9-8-15-22(28)27-23(30)29(20-12-6-4-5-7-13-20)21-14-10-11-19(17-21)18-26/h10-11,14,17,20,22H,4-9,12-13,15-16H2,1-3H3,(H,27,30) |
| InChIKey | OBVNDOVYJYPYQR-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |