C21H22ClNO4 — CID 54142640
2-[4-[2-[3-(4-chlorophenyl)prop-2-enoylamino]ethyl]phenoxy]-2-methylpropanoic acid (PubChem CID 54142640) has the molecular formula C21H22ClNO4 and a molecular weight of 387.86 g/mol. Its IUPAC name is 2-[4-[2-[3-(4-chlorophenyl)prop-2-enoylamino]ethyl]phenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[4-[2-[3-(4-chlorophenyl)prop-2-enoylamino]ethyl]phenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 54142640 |
| Molecular Formula | C21H22ClNO4 |
| Molecular Weight | 387.86 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 2-[4-[2-[3-(4-chlorophenyl)prop-2-enoylamino]ethyl]phenoxy]-2-methylpropanoic acid |
| SMILES | CC(C)(Oc1ccc(CCNC(=O)C=Cc2ccc(Cl)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C21H22ClNO4/c1-21(2,20(25)26)27-18-10-5-16(6-11-18)13-14-23-19(24)12-7-15-3-8-17(22)9-4-15/h3-12H,13-14H2,1-2H3,(H,23,24)(H,25,26) |
| InChIKey | OCDRRSQCTVTSFJ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.86 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|