C4H5NO3S — CID 54142958
4,5-dihydroxy-3-methyl-1,3-thiazol-2-one (PubChem CID 54142958) has the molecular formula C4H5NO3S and a molecular weight of 147.16 g/mol. Its IUPAC name is 4,5-dihydroxy-3-methyl-1,3-thiazol-2-one.
| Compound Name | 4,5-dihydroxy-3-methyl-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 54142958 |
| Molecular Formula | C4H5NO3S |
| Molecular Weight | 147.16 g/mol |
| Exact Mass | 147.00 |
| IUPAC Name | 4,5-dihydroxy-3-methyl-1,3-thiazol-2-one |
| SMILES | Cn1c(O)c(O)sc1=O |
| InChI | InChI=1S/C4H5NO3S/c1-5-2(6)3(7)9-4(5)8/h6-7H,1H3 |
| InChIKey | OCJAFEUYBAKFLJ-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.16 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |