About 4-hydroxy-3-methyl-5-sulfanyl-1,3-thiazol-2-one
4-hydroxy-3-methyl-5-sulfanyl-1,3-thiazol-2-one (PubChem CID 90927831) has the molecular formula C4H5NO2S2
and a molecular weight of 163.22 g/mol. Its IUPAC name is 4-hydroxy-3-methyl-5-sulfanyl-1,3-thiazol-2-one.
Molecular Properties
| Compound Name | 4-hydroxy-3-methyl-5-sulfanyl-1,3-thiazol-2-one |
| PubChem CID | 90927831 |
| Molecular Formula | C4H5NO2S2 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 162.98 |
| IUPAC Name | 4-hydroxy-3-methyl-5-sulfanyl-1,3-thiazol-2-one |
| SMILES | Cn1c(O)c(S)sc1=O |
| InChI | InChI=1S/C4H5NO2S2/c1-5-2(6)3(8)9-4(5)7/h6,8H,1H3 |
| InChIKey | WAVFQLSIQXWILM-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxy-3-methyl-5-sulfanyl-1,3-thiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-3-methyl-5-sulfanyl-1,3-thiazol-2-one?
The IUPAC name of 4-hydroxy-3-methyl-5-sulfanyl-1,3-thiazol-2-one (CID 90927831) is 4-hydroxy-3-methyl-5-sulfanyl-1,3-thiazol-2-one.
What is the SMILES notation for 4-hydroxy-3-methyl-5-sulfanyl-1,3-thiazol-2-one?
The canonical SMILES for 4-hydroxy-3-methyl-5-sulfanyl-1,3-thiazol-2-one is Cn1c(O)c(S)sc1=O.
What is the InChIKey of 4-hydroxy-3-methyl-5-sulfanyl-1,3-thiazol-2-one?
The InChIKey is WAVFQLSIQXWILM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO2S2/c1-5-2(6)3(8)9-4(5)7/h6,8H,1H3.
What are the key properties of 4-hydroxy-3-methyl-5-sulfanyl-1,3-thiazol-2-one?
4-hydroxy-3-methyl-5-sulfanyl-1,3-thiazol-2-one has a molecular weight of 163.22 g/mol, XLogP of 0.44, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-3-methyl-5-sulfanyl-1,3-thiazol-2-one is sourced from PubChem (CID 90927831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).