About CID 54145284
CID 54145284 (PubChem CID 54145284) has the molecular formula C3H5BO2
and a molecular weight of 83.88 g/mol.
Molecular Properties
| Compound Name | CID 54145284 |
| PubChem CID | 54145284 |
| Molecular Formula | C3H5BO2 |
| Molecular Weight | 83.88 g/mol |
| Exact Mass | 84.04 |
| IUPAC Name | — |
| SMILES | [B]C(C)C(=O)O |
| InChI | InChI=1S/C3H5BO2/c1-2(4)3(5)6/h2H,1H3,(H,5,6) |
| InChIKey | KMARXONGARAOOC-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 83.88 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 54145284 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 54145284?
The IUPAC name of CID 54145284 (CID 54145284) is not available.
What is the SMILES notation for CID 54145284?
The canonical SMILES for CID 54145284 is [B]C(C)C(=O)O.
What is the InChIKey of CID 54145284?
The InChIKey is KMARXONGARAOOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5BO2/c1-2(4)3(5)6/h2H,1H3,(H,5,6).
What are the key properties of CID 54145284?
CID 54145284 has a molecular weight of 83.88 g/mol, XLogP of 0.05, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 54145284 is sourced from PubChem (CID 54145284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).