C19H15ClF4N2O4 — CID 54145894
ethyl 2-[2-chloro-4-fluoro-5-(N-[(3,3,3-trifluoro-2-oxopropylidene)amino]anilino)phenoxy]acetate (PubChem CID 54145894) has the molecular formula C19H15ClF4N2O4 and a molecular weight of 446.78 g/mol. Its IUPAC name is ethyl 2-[2-chloro-4-fluoro-5-(N-[(3,3,3-trifluoro-2-oxopropylidene)amino]anilino)phenoxy]acetate.
| Compound Name | ethyl 2-[2-chloro-4-fluoro-5-(N-[(3,3,3-trifluoro-2-oxopropylidene)amino]anilino)phenoxy]acetate |
|---|---|
| PubChem CID | 54145894 |
| Molecular Formula | C19H15ClF4N2O4 |
| Molecular Weight | 446.78 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | ethyl 2-[2-chloro-4-fluoro-5-(N-[(3,3,3-trifluoro-2-oxopropylidene)amino]anilino)phenoxy]acetate |
| SMILES | CCOC(=O)COc1cc(N(N=CC(=O)C(F)(F)F)c2ccccc2)c(F)cc1Cl |
| InChI | InChI=1S/C19H15ClF4N2O4/c1-2-29-18(28)11-30-16-9-15(14(21)8-13(16)20)26(12-6-4-3-5-7-12)25-10-17(27)19(22,23)24/h3-10H,2,11H2,1H3 |
| InChIKey | OEIUQNCIJIXKJZ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.78 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|