C13H11ClFO6- — CID 22359301
3-[4-chloro-5-(2-ethoxy-2-oxoethoxy)-2-fluorophenyl]-3-oxopropanoate (PubChem CID 22359301) has the molecular formula C13H11ClFO6- and a molecular weight of 317.68 g/mol. Its IUPAC name is 3-[4-chloro-5-(2-ethoxy-2-oxoethoxy)-2-fluorophenyl]-3-oxopropanoate.
| Compound Name | 3-[4-chloro-5-(2-ethoxy-2-oxoethoxy)-2-fluorophenyl]-3-oxopropanoate |
|---|---|
| PubChem CID | 22359301 |
| Molecular Formula | C13H11ClFO6- |
| Molecular Weight | 317.68 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | 3-[4-chloro-5-(2-ethoxy-2-oxoethoxy)-2-fluorophenyl]-3-oxopropanoate |
| SMILES | CCOC(=O)COc1cc(C(=O)CC(=O)[O-])c(F)cc1Cl |
| InChI | InChI=1S/C13H12ClFO6/c1-2-20-13(19)6-21-11-3-7(9(15)4-8(11)14)10(16)5-12(17)18/h3-4H,2,5-6H2,1H3,(H,17,18)/p-1 |
| InChIKey | UPSKZRXPOXKNMN-UHFFFAOYSA-M |
| XLogP | 0.74 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.68 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|