C9H7ClFNO4 — CID 139634524
2-(5-carbamoyl-2-chloro-4-fluorophenoxy)acetic acid (PubChem CID 139634524) has the molecular formula C9H7ClFNO4 and a molecular weight of 247.61 g/mol. Its IUPAC name is 2-(5-carbamoyl-2-chloro-4-fluorophenoxy)acetic acid.
| Compound Name | 2-(5-carbamoyl-2-chloro-4-fluorophenoxy)acetic acid |
|---|---|
| PubChem CID | 139634524 |
| Molecular Formula | C9H7ClFNO4 |
| Molecular Weight | 247.61 g/mol |
| Exact Mass | 247.00 |
| IUPAC Name | 2-(5-carbamoyl-2-chloro-4-fluorophenoxy)acetic acid |
| SMILES | NC(=O)c1cc(OCC(=O)O)c(Cl)cc1F |
| InChI | InChI=1S/C9H7ClFNO4/c10-5-2-6(11)4(9(12)15)1-7(5)16-3-8(13)14/h1-2H,3H2,(H2,12,15)(H,13,14) |
| InChIKey | LXRJDHQDUSBPTK-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.61 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |