C15H17ClFNO5 — CID 174310963
[4-[5-(2-amino-2-oxoethoxy)-4-chloro-2-fluorophenyl]-2-methyl-4-oxobutan-2-yl] acetate (PubChem CID 174310963) has the molecular formula C15H17ClFNO5 and a molecular weight of 345.75 g/mol. Its IUPAC name is [4-[5-(2-amino-2-oxoethoxy)-4-chloro-2-fluorophenyl]-2-methyl-4-oxobutan-2-yl] acetate.
| Compound Name | [4-[5-(2-amino-2-oxoethoxy)-4-chloro-2-fluorophenyl]-2-methyl-4-oxobutan-2-yl] acetate |
|---|---|
| PubChem CID | 174310963 |
| Molecular Formula | C15H17ClFNO5 |
| Molecular Weight | 345.75 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | [4-[5-(2-amino-2-oxoethoxy)-4-chloro-2-fluorophenyl]-2-methyl-4-oxobutan-2-yl] acetate |
| SMILES | CC(=O)OC(C)(C)CC(=O)c1cc(OCC(N)=O)c(Cl)cc1F |
| InChI | InChI=1S/C15H17ClFNO5/c1-8(19)23-15(2,3)6-12(20)9-4-13(22-7-14(18)21)10(16)5-11(9)17/h4-5H,6-7H2,1-3H3,(H2,18,21) |
| InChIKey | LUVUBOMKSULJLN-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.75 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |