C16H15Cl2FN2O4 — CID 139884477
ethyl 2-[2-chloro-5-[5-chloro-6-(1-hydroxyethyl)pyrimidin-4-yl]-4-fluorophenoxy]acetate (PubChem CID 139884477) has the molecular formula C16H15Cl2FN2O4 and a molecular weight of 389.21 g/mol. Its IUPAC name is ethyl 2-[2-chloro-5-[5-chloro-6-(1-hydroxyethyl)pyrimidin-4-yl]-4-fluorophenoxy]acetate.
| Compound Name | ethyl 2-[2-chloro-5-[5-chloro-6-(1-hydroxyethyl)pyrimidin-4-yl]-4-fluorophenoxy]acetate |
|---|---|
| PubChem CID | 139884477 |
| Molecular Formula | C16H15Cl2FN2O4 |
| Molecular Weight | 389.21 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | ethyl 2-[2-chloro-5-[5-chloro-6-(1-hydroxyethyl)pyrimidin-4-yl]-4-fluorophenoxy]acetate |
| SMILES | CCOC(=O)COc1cc(-c2ncnc(C(C)O)c2Cl)c(F)cc1Cl |
| InChI | InChI=1S/C16H15Cl2FN2O4/c1-3-24-13(23)6-25-12-4-9(11(19)5-10(12)17)16-14(18)15(8(2)22)20-7-21-16/h4-5,7-8,22H,3,6H2,1-2H3 |
| InChIKey | MYISBDJMKXXAER-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.21 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |