C16H13Cl2FN2O — CID 142043392
4-(5-but-3-yn-2-yloxy-4-chloro-2-fluorophenyl)-5-chloro-6-ethylpyrimidine (PubChem CID 142043392) has the molecular formula C16H13Cl2FN2O and a molecular weight of 339.20 g/mol. Its IUPAC name is 4-(5-but-3-yn-2-yloxy-4-chloro-2-fluorophenyl)-5-chloro-6-ethylpyrimidine.
| Compound Name | 4-(5-but-3-yn-2-yloxy-4-chloro-2-fluorophenyl)-5-chloro-6-ethylpyrimidine |
|---|---|
| PubChem CID | 142043392 |
| Molecular Formula | C16H13Cl2FN2O |
| Molecular Weight | 339.20 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | 4-(5-but-3-yn-2-yloxy-4-chloro-2-fluorophenyl)-5-chloro-6-ethylpyrimidine |
| SMILES | C#CC(C)Oc1cc(-c2ncnc(CC)c2Cl)c(F)cc1Cl |
| InChI | InChI=1S/C16H13Cl2FN2O/c1-4-9(3)22-14-6-10(12(19)7-11(14)17)16-15(18)13(5-2)20-8-21-16/h1,6-9H,5H2,2-3H3 |
| InChIKey | BHCCMFQGQNSKFJ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.20 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|