C24H22Cl3FN2O3 — CID 139967372
ethyl 2-chloro-3-[2-chloro-5-[[4-(5-chloro-6-ethylpyrimidin-4-yl)-3-fluorophenoxy]methyl]phenyl]propanoate (PubChem CID 139967372) has the molecular formula C24H22Cl3FN2O3 and a molecular weight of 511.81 g/mol. Its IUPAC name is ethyl 2-chloro-3-[2-chloro-5-[[4-(5-chloro-6-ethylpyrimidin-4-yl)-3-fluorophenoxy]methyl]phenyl]propanoate.
| Compound Name | ethyl 2-chloro-3-[2-chloro-5-[[4-(5-chloro-6-ethylpyrimidin-4-yl)-3-fluorophenoxy]methyl]phenyl]propanoate |
|---|---|
| PubChem CID | 139967372 |
| Molecular Formula | C24H22Cl3FN2O3 |
| Molecular Weight | 511.81 g/mol |
| Exact Mass | 510.07 |
| IUPAC Name | ethyl 2-chloro-3-[2-chloro-5-[[4-(5-chloro-6-ethylpyrimidin-4-yl)-3-fluorophenoxy]methyl]phenyl]propanoate |
| SMILES | CCOC(=O)C(Cl)Cc1cc(COc2ccc(-c3ncnc(CC)c3Cl)c(F)c2)ccc1Cl |
| InChI | InChI=1S/C24H22Cl3FN2O3/c1-3-21-22(27)23(30-13-29-21)17-7-6-16(11-20(17)28)33-12-14-5-8-18(25)15(9-14)10-19(26)24(31)32-4-2/h5-9,11,13,19H,3-4,10,12H2,1-2H3 |
| InChIKey | HHLSQEJTGPXRPB-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.81 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|