C12H11BrF2O4 — CID 18620132
ethyl 2-[4-(2-bromoacetyl)-2,5-difluorophenoxy]acetate (PubChem CID 18620132) has the molecular formula C12H11BrF2O4 and a molecular weight of 337.12 g/mol. Its IUPAC name is ethyl 2-[4-(2-bromoacetyl)-2,5-difluorophenoxy]acetate.
| Compound Name | ethyl 2-[4-(2-bromoacetyl)-2,5-difluorophenoxy]acetate |
|---|---|
| PubChem CID | 18620132 |
| Molecular Formula | C12H11BrF2O4 |
| Molecular Weight | 337.12 g/mol |
| Exact Mass | 335.98 |
| IUPAC Name | ethyl 2-[4-(2-bromoacetyl)-2,5-difluorophenoxy]acetate |
| SMILES | CCOC(=O)COc1cc(F)c(C(=O)CBr)cc1F |
| InChI | InChI=1S/C12H11BrF2O4/c1-2-18-12(17)6-19-11-4-8(14)7(3-9(11)15)10(16)5-13/h3-4H,2,5-6H2,1H3 |
| InChIKey | OICIIVVZDKKLAU-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.12 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|