C17H21ClN2O2 — CID 54146838
3-[(3-chloro-2-methylphenyl)methylamino]-4-(2-methylbutan-2-ylamino)cyclobut-3-ene-1,2-dione (PubChem CID 54146838) has the molecular formula C17H21ClN2O2 and a molecular weight of 320.82 g/mol. Its IUPAC name is 3-[(3-chloro-2-methylphenyl)methylamino]-4-(2-methylbutan-2-ylamino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[(3-chloro-2-methylphenyl)methylamino]-4-(2-methylbutan-2-ylamino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 54146838 |
| Molecular Formula | C17H21ClN2O2 |
| Molecular Weight | 320.82 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 3-[(3-chloro-2-methylphenyl)methylamino]-4-(2-methylbutan-2-ylamino)cyclobut-3-ene-1,2-dione |
| SMILES | CCC(C)(C)Nc1c(NCc2cccc(Cl)c2C)c(=O)c1=O |
| InChI | InChI=1S/C17H21ClN2O2/c1-5-17(3,4)20-14-13(15(21)16(14)22)19-9-11-7-6-8-12(18)10(11)2/h6-8,19-20H,5,9H2,1-4H3 |
| InChIKey | OEYWMISUAGIYIZ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.82 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|