C21H38O5 — CID 54147936
3-hydroxy-7-[(1S,2S)-2-(3-hydroxyoct-1-enyl)cyclopentyl]-2-methoxyheptanoic acid (PubChem CID 54147936) has the molecular formula C21H38O5 and a molecular weight of 370.53 g/mol. Its IUPAC name is 3-hydroxy-7-[(1S,2S)-2-(3-hydroxyoct-1-enyl)cyclopentyl]-2-methoxyheptanoic acid.
| Compound Name | 3-hydroxy-7-[(1S,2S)-2-(3-hydroxyoct-1-enyl)cyclopentyl]-2-methoxyheptanoic acid |
|---|---|
| PubChem CID | 54147936 |
| Molecular Formula | C21H38O5 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.27 |
| IUPAC Name | 3-hydroxy-7-[(1S,2S)-2-(3-hydroxyoct-1-enyl)cyclopentyl]-2-methoxyheptanoic acid |
| SMILES | CCCCCC(O)C=C[C@H]1CCC[C@@H]1CCCCC(O)C(OC)C(=O)O |
| InChI | InChI=1S/C21H38O5/c1-3-4-5-12-18(22)15-14-17-11-8-10-16(17)9-6-7-13-19(23)20(26-2)21(24)25/h14-20,22-23H,3-13H2,1-2H3,(H,24,25)/t16-,17+,18?,19?,20?/m0/s1 |
| InChIKey | OFRUZYWQGGKTAB-RWTLDIJBSA-N |
| XLogP | 3.92 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|