C19H21N3O3 — CID 54148819
methyl (4S,5S)-2-benzyl-5-(3-carbamimidoylphenyl)-1,2-oxazolidine-4-carboxylate (PubChem CID 54148819) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is methyl (4S,5S)-2-benzyl-5-(3-carbamimidoylphenyl)-1,2-oxazolidine-4-carboxylate.
| Compound Name | methyl (4S,5S)-2-benzyl-5-(3-carbamimidoylphenyl)-1,2-oxazolidine-4-carboxylate |
|---|---|
| PubChem CID | 54148819 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | methyl (4S,5S)-2-benzyl-5-(3-carbamimidoylphenyl)-1,2-oxazolidine-4-carboxylate |
| SMILES | [H]/N=C(\N)c1cccc([C@H]2ON(Cc3ccccc3)C[C@@H]2C(=O)OC)c1 |
| InChI | InChI=1S/C19H21N3O3/c1-24-19(23)16-12-22(11-13-6-3-2-4-7-13)25-17(16)14-8-5-9-15(10-14)18(20)21/h2-10,16-17H,11-12H2,1H3,(H3,20,21)/t16-,17+/m0/s1 |
| InChIKey | OGHFWRBNRGOOHL-DLBZAZTESA-N |
| XLogP | 2.25 |
| TPSA | 88.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|