C19H20FNO — CID 54149340
9-(3-fluorophenyl)-3,4,5,6,7,8,8a,9-octahydro-2H-acridin-1-one (PubChem CID 54149340) has the molecular formula C19H20FNO and a molecular weight of 297.37 g/mol. Its IUPAC name is 9-(3-fluorophenyl)-3,4,5,6,7,8,8a,9-octahydro-2H-acridin-1-one.
| Compound Name | 9-(3-fluorophenyl)-3,4,5,6,7,8,8a,9-octahydro-2H-acridin-1-one |
|---|---|
| PubChem CID | 54149340 |
| Molecular Formula | C19H20FNO |
| Molecular Weight | 297.37 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 9-(3-fluorophenyl)-3,4,5,6,7,8,8a,9-octahydro-2H-acridin-1-one |
| SMILES | O=C1CCCC2=C1C(c1cccc(F)c1)C1CCCCC1=N2 |
| InChI | InChI=1S/C19H20FNO/c20-13-6-3-5-12(11-13)18-14-7-1-2-8-15(14)21-16-9-4-10-17(22)19(16)18/h3,5-6,11,14,18H,1-2,4,7-10H2 |
| InChIKey | OGQQENVFDXLVNY-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.37 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |