C45H28F6N2O8S — CID 54150845
5-[1,1,1,3,3,3-hexafluoro-2-[2-[3-[4-[4-(3-methylphenoxy)phenyl]sulfonylphenoxy]phenyl]-1,3-dioxoisoindol-5-yl]propan-2-yl]-2-methylisoindole-1,3-dione (PubChem CID 54150845) has the molecular formula C45H28F6N2O8S and a molecular weight of 870.78 g/mol. Its IUPAC name is 5-[1,1,1,3,3,3-hexafluoro-2-[2-[3-[4-[4-(3-methylphenoxy)phenyl]sulfonylphenoxy]phenyl]-1,3-dioxoisoindol-5-yl]propan-2-yl]-2-methylisoindole-1,3-dione.
| Compound Name | 5-[1,1,1,3,3,3-hexafluoro-2-[2-[3-[4-[4-(3-methylphenoxy)phenyl]sulfonylphenoxy]phenyl]-1,3-dioxoisoindol-5-yl]propan-2-yl]-2-methylisoindole-1,3-dione |
|---|---|
| PubChem CID | 54150845 |
| Molecular Formula | C45H28F6N2O8S |
| Molecular Weight | 870.78 g/mol |
| Exact Mass | 870.15 |
| IUPAC Name | 5-[1,1,1,3,3,3-hexafluoro-2-[2-[3-[4-[4-(3-methylphenoxy)phenyl]sulfonylphenoxy]phenyl]-1,3-dioxoisoindol-5-yl]propan-2-yl]-2-methylisoindole-1,3-dione |
| SMILES | Cc1cccc(Oc2ccc(S(=O)(=O)c3ccc(Oc4cccc(N5C(=O)c6ccc(C(c7ccc8c(c7)C(=O)N(C)C8=O)(C(F)(F)F)C(F)(F)F)cc6C5=O)c4)cc3)cc2)c1 |
| InChI | InChI=1S/C45H28F6N2O8S/c1-25-5-3-7-31(21-25)60-29-11-15-33(16-12-29)62(58,59)34-17-13-30(14-18-34)61-32-8-4-6-28(24-32)53-41(56)36-20-10-27(23-38(36)42(53)57)43(44(46,47)48,45(49,50)51)26-9-19-35-37(22-26)40(55)52(2)39(35)54/h3-24H,1-2H3 |
| InChIKey | OHPYHSDRRMPAMH-UHFFFAOYSA-N |
| XLogP | 9.85 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 870.78 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|