C46H28F6N2O6 — CID 59937274
5-[2-[2-(3-ethenylphenyl)-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-[3-[3-(3-methylphenoxy)phenoxy]phenyl]isoindole-1,3-dione (PubChem CID 59937274) has the molecular formula C46H28F6N2O6 and a molecular weight of 818.73 g/mol. Its IUPAC name is 5-[2-[2-(3-ethenylphenyl)-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-[3-[3-(3-methylphenoxy)phenoxy]phenyl]isoindole-1,3-dione.
| Compound Name | 5-[2-[2-(3-ethenylphenyl)-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-[3-[3-(3-methylphenoxy)phenoxy]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 59937274 |
| Molecular Formula | C46H28F6N2O6 |
| Molecular Weight | 818.73 g/mol |
| Exact Mass | 818.19 |
| IUPAC Name | 5-[2-[2-(3-ethenylphenyl)-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-[3-[3-(3-methylphenoxy)phenoxy]phenyl]isoindole-1,3-dione |
| SMILES | C=Cc1cccc(N2C(=O)c3ccc(C(c4ccc5c(c4)C(=O)N(c4cccc(Oc6cccc(Oc7cccc(C)c7)c6)c4)C5=O)(C(F)(F)F)C(F)(F)F)cc3C2=O)c1 |
| InChI | InChI=1S/C46H28F6N2O6/c1-3-27-9-5-10-30(21-27)53-40(55)36-18-16-28(22-38(36)42(53)57)44(45(47,48)49,46(50,51)52)29-17-19-37-39(23-29)43(58)54(41(37)56)31-11-6-13-33(24-31)60-35-15-7-14-34(25-35)59-32-12-4-8-26(2)20-32/h3-25H,1H2,2H3 |
| InChIKey | NCTUAXMHCKEEPQ-UHFFFAOYSA-N |
| XLogP | 11.23 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.73 |
| LogP ≤ 5 | 11.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|