C37H23F3N2O7 — CID 18730835
2-methyl-5-[2-[3-[3-(3-methylphenoxy)-5-(trifluoromethyl)phenoxy]phenyl]-1,3-dioxoisoindol-5-yl]oxyisoindole-1,3-dione (PubChem CID 18730835) has the molecular formula C37H23F3N2O7 and a molecular weight of 664.59 g/mol. Its IUPAC name is 2-methyl-5-[2-[3-[3-(3-methylphenoxy)-5-(trifluoromethyl)phenoxy]phenyl]-1,3-dioxoisoindol-5-yl]oxyisoindole-1,3-dione.
| Compound Name | 2-methyl-5-[2-[3-[3-(3-methylphenoxy)-5-(trifluoromethyl)phenoxy]phenyl]-1,3-dioxoisoindol-5-yl]oxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 18730835 |
| Molecular Formula | C37H23F3N2O7 |
| Molecular Weight | 664.59 g/mol |
| Exact Mass | 664.15 |
| IUPAC Name | 2-methyl-5-[2-[3-[3-(3-methylphenoxy)-5-(trifluoromethyl)phenoxy]phenyl]-1,3-dioxoisoindol-5-yl]oxyisoindole-1,3-dione |
| SMILES | Cc1cccc(Oc2cc(Oc3cccc(N4C(=O)c5ccc(Oc6ccc7c(c6)C(=O)N(C)C7=O)cc5C4=O)c3)cc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C37H23F3N2O7/c1-20-5-3-7-23(13-20)48-27-14-21(37(38,39)40)15-28(17-27)49-24-8-4-6-22(16-24)42-35(45)30-12-10-26(19-32(30)36(42)46)47-25-9-11-29-31(18-25)34(44)41(2)33(29)43/h3-19H,1-2H3 |
| InChIKey | FLDAHVZSIAHLGX-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.59 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|