C13H19NO2 — CID 54151770
5,5-dimethyl-2-(2-methyl-3,4-dihydro-2H-pyrrol-5-yl)cyclohexane-1,3-dione (PubChem CID 54151770) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 5,5-dimethyl-2-(2-methyl-3,4-dihydro-2H-pyrrol-5-yl)cyclohexane-1,3-dione.
| Compound Name | 5,5-dimethyl-2-(2-methyl-3,4-dihydro-2H-pyrrol-5-yl)cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 54151770 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 5,5-dimethyl-2-(2-methyl-3,4-dihydro-2H-pyrrol-5-yl)cyclohexane-1,3-dione |
| SMILES | CC1CCC(C2C(=O)CC(C)(C)CC2=O)=N1 |
| InChI | InChI=1S/C13H19NO2/c1-8-4-5-9(14-8)12-10(15)6-13(2,3)7-11(12)16/h8,12H,4-7H2,1-3H3 |
| InChIKey | OIGBCEPMHFIQBF-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|