C18H22N4O6 — CID 54155695
diethyl 2,6-diamino-3-methyl-4-(3-nitrophenyl)-4H-pyridine-3,5-dicarboxylate (PubChem CID 54155695) has the molecular formula C18H22N4O6 and a molecular weight of 390.40 g/mol. Its IUPAC name is diethyl 2,6-diamino-3-methyl-4-(3-nitrophenyl)-4H-pyridine-3,5-dicarboxylate.
| Compound Name | diethyl 2,6-diamino-3-methyl-4-(3-nitrophenyl)-4H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 54155695 |
| Molecular Formula | C18H22N4O6 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | diethyl 2,6-diamino-3-methyl-4-(3-nitrophenyl)-4H-pyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(N)N=C(N)C(C)(C(=O)OCC)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H22N4O6/c1-4-27-15(23)12-13(10-7-6-8-11(9-10)22(25)26)18(3,17(24)28-5-2)16(20)21-14(12)19/h6-9,13H,4-5,19H2,1-3H3,(H2,20,21) |
| InChIKey | OKWMSSSHTVEYIF-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 160.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|