C31H48N3O6+ — CID 54370888
[3,5-bis(ethoxycarbonyl)-2-methyl-4-(3-nitrophenyl)-3,4-dihydropyridin-6-yl]methyl-tributylazanium (PubChem CID 54370888) has the molecular formula C31H48N3O6+ and a molecular weight of 558.74 g/mol. Its IUPAC name is [3,5-bis(ethoxycarbonyl)-2-methyl-4-(3-nitrophenyl)-3,4-dihydropyridin-6-yl]methyl-tributylazanium.
| Compound Name | [3,5-bis(ethoxycarbonyl)-2-methyl-4-(3-nitrophenyl)-3,4-dihydropyridin-6-yl]methyl-tributylazanium |
|---|---|
| PubChem CID | 54370888 |
| Molecular Formula | C31H48N3O6+ |
| Molecular Weight | 558.74 g/mol |
| Exact Mass | 558.35 |
| IUPAC Name | [3,5-bis(ethoxycarbonyl)-2-methyl-4-(3-nitrophenyl)-3,4-dihydropyridin-6-yl]methyl-tributylazanium |
| SMILES | CCCC[N+](CCCC)(CCCC)CC1=C(C(=O)OCC)C(c2cccc([N+](=O)[O-])c2)C(C(=O)OCC)C(C)=N1 |
| InChI | InChI=1S/C31H48N3O6/c1-7-12-18-34(19-13-8-2,20-14-9-3)22-26-29(31(36)40-11-5)28(24-16-15-17-25(21-24)33(37)38)27(23(6)32-26)30(35)39-10-4/h15-17,21,27-28H,7-14,18-20,22H2,1-6H3/q+1 |
| InChIKey | UTCQAPPGDVJJNG-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 108.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.74 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|