C28H31N5O6 — CID 54135817
5-O-ethyl 3-O-propan-2-yl 6-(3-azido-3-phenylpropyl)-2-methyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 54135817) has the molecular formula C28H31N5O6 and a molecular weight of 533.59 g/mol. Its IUPAC name is 5-O-ethyl 3-O-propan-2-yl 6-(3-azido-3-phenylpropyl)-2-methyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-ethyl 3-O-propan-2-yl 6-(3-azido-3-phenylpropyl)-2-methyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 54135817 |
| Molecular Formula | C28H31N5O6 |
| Molecular Weight | 533.59 g/mol |
| Exact Mass | 533.23 |
| IUPAC Name | 5-O-ethyl 3-O-propan-2-yl 6-(3-azido-3-phenylpropyl)-2-methyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(CCC(N=[N+]=[N-])c2ccccc2)N=C(C)C(C(=O)OC(C)C)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H31N5O6/c1-5-38-27(34)26-23(15-14-22(31-32-29)19-10-7-6-8-11-19)30-18(4)24(28(35)39-17(2)3)25(26)20-12-9-13-21(16-20)33(36)37/h6-13,16-17,22,24-25H,5,14-15H2,1-4H3 |
| InChIKey | NXPQFXDZUMWKKS-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 156.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.59 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|