C29H20F3N7O — CID 54156917
N-[4-[(2-benzylbenzo[e]indazol-5-yl)amino]pyrido[3,4-d]pyrimidin-6-yl]-4,4,4-trifluorobut-2-enamide (PubChem CID 54156917) has the molecular formula C29H20F3N7O and a molecular weight of 539.52 g/mol. Its IUPAC name is N-[4-[(2-benzylbenzo[e]indazol-5-yl)amino]pyrido[3,4-d]pyrimidin-6-yl]-4,4,4-trifluorobut-2-enamide.
| Compound Name | N-[4-[(2-benzylbenzo[e]indazol-5-yl)amino]pyrido[3,4-d]pyrimidin-6-yl]-4,4,4-trifluorobut-2-enamide |
|---|---|
| PubChem CID | 54156917 |
| Molecular Formula | C29H20F3N7O |
| Molecular Weight | 539.52 g/mol |
| Exact Mass | 539.17 |
| IUPAC Name | N-[4-[(2-benzylbenzo[e]indazol-5-yl)amino]pyrido[3,4-d]pyrimidin-6-yl]-4,4,4-trifluorobut-2-enamide |
| SMILES | O=C(C=CC(F)(F)F)Nc1cc2c(Nc3cc4nn(Cc5ccccc5)cc4c4ccccc34)ncnc2cn1 |
| InChI | InChI=1S/C29H20F3N7O/c30-29(31,32)11-10-27(40)37-26-12-21-25(14-33-26)34-17-35-28(21)36-23-13-24-22(19-8-4-5-9-20(19)23)16-39(38-24)15-18-6-2-1-3-7-18/h1-14,16-17H,15H2,(H,33,37,40)(H,34,35,36) |
| InChIKey | OLSNCEYPRPLBNV-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.52 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|