C12H16BrFN4O2 — CID 54156923
1-N'-[(6-bromo-3-pyridinyl)methyl]-1-N'-(2-fluoroethyl)-1-N,1-N-dimethyl-2-nitroethene-1,1-diamine (PubChem CID 54156923) has the molecular formula C12H16BrFN4O2 and a molecular weight of 347.19 g/mol. Its IUPAC name is 1-N'-[(6-bromo-3-pyridinyl)methyl]-1-N'-(2-fluoroethyl)-1-N,1-N-dimethyl-2-nitroethene-1,1-diamine.
| Compound Name | 1-N'-[(6-bromo-3-pyridinyl)methyl]-1-N'-(2-fluoroethyl)-1-N,1-N-dimethyl-2-nitroethene-1,1-diamine |
|---|---|
| PubChem CID | 54156923 |
| Molecular Formula | C12H16BrFN4O2 |
| Molecular Weight | 347.19 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | 1-N'-[(6-bromo-3-pyridinyl)methyl]-1-N'-(2-fluoroethyl)-1-N,1-N-dimethyl-2-nitroethene-1,1-diamine |
| SMILES | CN(C)C(=C[N+](=O)[O-])N(CCF)Cc1ccc(Br)nc1 |
| InChI | InChI=1S/C12H16BrFN4O2/c1-16(2)12(9-18(19)20)17(6-5-14)8-10-3-4-11(13)15-7-10/h3-4,7,9H,5-6,8H2,1-2H3 |
| InChIKey | OLSQROSPSBIWPK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 62.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.19 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|