About hex-2-enyl N-[(2S)-4-methyl-1-(3-methylbutylamino)-1-oxopentan-2-yl]carbamate
hex-2-enyl N-[(2S)-4-methyl-1-(3-methylbutylamino)-1-oxopentan-2-yl]carbamate (PubChem CID 54157141) has the molecular formula C18H34N2O3
and a molecular weight of 326.48 g/mol. Its IUPAC name is hex-2-enyl N-[(2S)-4-methyl-1-(3-methylbutylamino)-1-oxopentan-2-yl]carbamate.
Molecular Properties
| Compound Name | hex-2-enyl N-[(2S)-4-methyl-1-(3-methylbutylamino)-1-oxopentan-2-yl]carbamate |
| PubChem CID | 54157141 |
| Molecular Formula | C18H34N2O3 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.26 |
| IUPAC Name | hex-2-enyl N-[(2S)-4-methyl-1-(3-methylbutylamino)-1-oxopentan-2-yl]carbamate |
| SMILES | CCCC=CCOC(=O)N[C@@H](CC(C)C)C(=O)NCCC(C)C |
| InChI | InChI=1S/C18H34N2O3/c1-6-7-8-9-12-23-18(22)20-16(13-15(4)5)17(21)19-11-10-14(2)3/h8-9,14-16H,6-7,10-13H2,1-5H3,(H,19,21)(H,20,22)/t16-/m0/s1 |
| InChIKey | OLWJKZBMONTJEE-INIZCTEOSA-N |
| XLogP | 3.65 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze hex-2-enyl N-[(2S)-4-methyl-1-(3-methylbutylamino)-1-oxopentan-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hex-2-enyl N-[(2S)-4-methyl-1-(3-methylbutylamino)-1-oxopentan-2-yl]carbamate?
The IUPAC name of hex-2-enyl N-[(2S)-4-methyl-1-(3-methylbutylamino)-1-oxopentan-2-yl]carbamate (CID 54157141) is hex-2-enyl N-[(2S)-4-methyl-1-(3-methylbutylamino)-1-oxopentan-2-yl]carbamate.
What is the SMILES notation for hex-2-enyl N-[(2S)-4-methyl-1-(3-methylbutylamino)-1-oxopentan-2-yl]carbamate?
The canonical SMILES for hex-2-enyl N-[(2S)-4-methyl-1-(3-methylbutylamino)-1-oxopentan-2-yl]carbamate is CCCC=CCOC(=O)N[C@@H](CC(C)C)C(=O)NCCC(C)C.
What is the InChIKey of hex-2-enyl N-[(2S)-4-methyl-1-(3-methylbutylamino)-1-oxopentan-2-yl]carbamate?
The InChIKey is OLWJKZBMONTJEE-INIZCTEOSA-N. The full InChI is InChI=1S/C18H34N2O3/c1-6-7-8-9-12-23-18(22)20-16(13-15(4)5)17(21)19-11-10-14(2)3/h8-9,14-16H,6-7,10-13H2,1-5H3,(H,19,21)(H,20,22)/t16-/m0/s1.
What are the key properties of hex-2-enyl N-[(2S)-4-methyl-1-(3-methylbutylamino)-1-oxopentan-2-yl]carbamate?
hex-2-enyl N-[(2S)-4-methyl-1-(3-methylbutylamino)-1-oxopentan-2-yl]carbamate has a molecular weight of 326.48 g/mol, XLogP of 3.65, 11 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hex-2-enyl N-[(2S)-4-methyl-1-(3-methylbutylamino)-1-oxopentan-2-yl]carbamate is sourced from PubChem (CID 54157141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).