C18H34N2O3 — CID 54378636
hex-1-enyl N-[(2S)-4-methyl-1-(3-methylbutylamino)-1-oxopentan-2-yl]carbamate (PubChem CID 54378636) has the molecular formula C18H34N2O3 and a molecular weight of 326.48 g/mol. Its IUPAC name is hex-1-enyl N-[(2S)-4-methyl-1-(3-methylbutylamino)-1-oxopentan-2-yl]carbamate.
| Compound Name | hex-1-enyl N-[(2S)-4-methyl-1-(3-methylbutylamino)-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 54378636 |
| Molecular Formula | C18H34N2O3 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.26 |
| IUPAC Name | hex-1-enyl N-[(2S)-4-methyl-1-(3-methylbutylamino)-1-oxopentan-2-yl]carbamate |
| SMILES | CCCCC=COC(=O)N[C@@H](CC(C)C)C(=O)NCCC(C)C |
| InChI | InChI=1S/C18H34N2O3/c1-6-7-8-9-12-23-18(22)20-16(13-15(4)5)17(21)19-11-10-14(2)3/h9,12,14-16H,6-8,10-11,13H2,1-5H3,(H,19,21)(H,20,22)/t16-/m0/s1 |
| InChIKey | UYIUDKJJTNGEJU-INIZCTEOSA-N |
| XLogP | 3.99 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|