C8H15N5 — CID 54157511
4-N,4-N-diethylpyrimidine-2,4,6-triamine (PubChem CID 54157511) has the molecular formula C8H15N5 and a molecular weight of 181.24 g/mol. Its IUPAC name is 4-N,4-N-diethylpyrimidine-2,4,6-triamine.
| Compound Name | 4-N,4-N-diethylpyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 54157511 |
| Molecular Formula | C8H15N5 |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | 4-N,4-N-diethylpyrimidine-2,4,6-triamine |
| SMILES | CCN(CC)c1cc(N)nc(N)n1 |
| InChI | InChI=1S/C8H15N5/c1-3-13(4-2)7-5-6(9)11-8(10)12-7/h5H,3-4H2,1-2H3,(H4,9,10,11,12) |
| InChIKey | OMCXLIAQPPOTIC-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |