C10H21N3O2 — CID 54159206
7,9-diamino-5-(aminomethyl)-6-oxononanal (PubChem CID 54159206) has the molecular formula C10H21N3O2 and a molecular weight of 215.30 g/mol. Its IUPAC name is 7,9-diamino-5-(aminomethyl)-6-oxononanal.
| Compound Name | 7,9-diamino-5-(aminomethyl)-6-oxononanal |
|---|---|
| PubChem CID | 54159206 |
| Molecular Formula | C10H21N3O2 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.16 |
| IUPAC Name | 7,9-diamino-5-(aminomethyl)-6-oxononanal |
| SMILES | NCCC(N)C(=O)C(CN)CCCC=O |
| InChI | InChI=1S/C10H21N3O2/c11-5-4-9(13)10(15)8(7-12)3-1-2-6-14/h6,8-9H,1-5,7,11-13H2 |
| InChIKey | YCXHPDOXFFRMFG-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 112.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|