C7H7N — CID 54160438
2-azabicyclo[4.2.0]octa-2,5,7-triene (PubChem CID 54160438) has the molecular formula C7H7N and a molecular weight of 105.14 g/mol. Its IUPAC name is 2-azabicyclo[4.2.0]octa-2,5,7-triene.
| Compound Name | 2-azabicyclo[4.2.0]octa-2,5,7-triene |
|---|---|
| PubChem CID | 54160438 |
| Molecular Formula | C7H7N |
| Molecular Weight | 105.14 g/mol |
| Exact Mass | 105.06 |
| IUPAC Name | 2-azabicyclo[4.2.0]octa-2,5,7-triene |
| SMILES | C1=CC2N=CCC=C12 |
| InChI | InChI=1S/C7H7N/c1-2-6-3-4-7(6)8-5-1/h2-5,7H,1H2 |
| InChIKey | ZPGIEYLONAREDA-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 105.14 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |