C15H13N — CID 91001318
(1Z)-8-azatricyclo[10.4.0.02,7]hexadeca-1,3,5,8,11,13,15-heptaene (PubChem CID 91001318) has the molecular formula C15H13N and a molecular weight of 207.28 g/mol. Its IUPAC name is (1Z)-8-azatricyclo[10.4.0.02,7]hexadeca-1,3,5,8,11,13,15-heptaene.
| Compound Name | (1Z)-8-azatricyclo[10.4.0.02,7]hexadeca-1,3,5,8,11,13,15-heptaene |
|---|---|
| PubChem CID | 91001318 |
| Molecular Formula | C15H13N |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | (1Z)-8-azatricyclo[10.4.0.02,7]hexadeca-1,3,5,8,11,13,15-heptaene |
| SMILES | C1=C/C2=c3\ccccc3=CC/C=N\C2C=C1 |
| InChI | InChI=1S/C15H13N/c1-2-8-13-12(6-1)7-5-11-16-15-10-4-3-9-14(13)15/h1-4,6-11,15H,5H2/b12-7?,14-13-,16-11- |
| InChIKey | HALIPYJVNOAIBG-GWQFUYAHSA-N |
| XLogP | 1.59 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |