C14H22O7 — CID 54160606
[(2R)-2-[(1S)-1,2-dihydroxyethyl]-4,5-dioxooxolan-3-yl] octanoate (PubChem CID 54160606) has the molecular formula C14H22O7 and a molecular weight of 302.32 g/mol. Its IUPAC name is [(2R)-2-[(1S)-1,2-dihydroxyethyl]-4,5-dioxooxolan-3-yl] octanoate.
| Compound Name | [(2R)-2-[(1S)-1,2-dihydroxyethyl]-4,5-dioxooxolan-3-yl] octanoate |
|---|---|
| PubChem CID | 54160606 |
| Molecular Formula | C14H22O7 |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | [(2R)-2-[(1S)-1,2-dihydroxyethyl]-4,5-dioxooxolan-3-yl] octanoate |
| SMILES | CCCCCCCC(=O)OC1C(=O)C(=O)O[C@@H]1[C@@H](O)CO |
| InChI | InChI=1S/C14H22O7/c1-2-3-4-5-6-7-10(17)20-13-11(18)14(19)21-12(13)9(16)8-15/h9,12-13,15-16H,2-8H2,1H3/t9-,12+,13?/m0/s1 |
| InChIKey | OODAMSOSKMIUER-XAWKZAOJSA-N |
| XLogP | 0.11 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|