C15H18N2O5 — CID 5416199
(5Z)-3-ethyl-5-[(2,4,6-trimethoxyphenyl)methylidene]imidazolidine-2,4-dione (PubChem CID 5416199) has the molecular formula C15H18N2O5 and a molecular weight of 306.32 g/mol. Its IUPAC name is (5Z)-3-ethyl-5-[(2,4,6-trimethoxyphenyl)methylidene]imidazolidine-2,4-dione.
| Compound Name | (5Z)-3-ethyl-5-[(2,4,6-trimethoxyphenyl)methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 5416199 |
| Molecular Formula | C15H18N2O5 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | (5Z)-3-ethyl-5-[(2,4,6-trimethoxyphenyl)methylidene]imidazolidine-2,4-dione |
| SMILES | CCN1C(=O)N/C(=C\c2c(OC)cc(OC)cc2OC)C1=O |
| InChI | InChI=1S/C15H18N2O5/c1-5-17-14(18)11(16-15(17)19)8-10-12(21-3)6-9(20-2)7-13(10)22-4/h6-8H,5H2,1-4H3,(H,16,19)/b11-8- |
| InChIKey | LVFSPIHMACSUAG-FLIBITNWSA-N |
| XLogP | 1.62 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|