C17H22O5 — CID 54165322
5-hydroxy-5-[4-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]hex-2-enoic acid (PubChem CID 54165322) has the molecular formula C17H22O5 and a molecular weight of 306.36 g/mol. Its IUPAC name is 5-hydroxy-5-[4-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]hex-2-enoic acid.
| Compound Name | 5-hydroxy-5-[4-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]hex-2-enoic acid |
|---|---|
| PubChem CID | 54165322 |
| Molecular Formula | C17H22O5 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 5-hydroxy-5-[4-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]hex-2-enoic acid |
| SMILES | CC(C)(C)OC(=O)c1ccc(C(C)(O)CC=CC(=O)O)cc1 |
| InChI | InChI=1S/C17H22O5/c1-16(2,3)22-15(20)12-7-9-13(10-8-12)17(4,21)11-5-6-14(18)19/h5-10,21H,11H2,1-4H3,(H,18,19) |
| InChIKey | ORGGUZNMEXUXPM-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|