About (2-ethoxy-2-oxoethyl) 2-(3-methylthiophen-2-yl)acetate
(2-ethoxy-2-oxoethyl) 2-(3-methylthiophen-2-yl)acetate (PubChem CID 54165480) has the molecular formula C11H14O4S
and a molecular weight of 242.30 g/mol. Its IUPAC name is (2-ethoxy-2-oxoethyl) 2-(3-methylthiophen-2-yl)acetate.
Molecular Properties
| Compound Name | (2-ethoxy-2-oxoethyl) 2-(3-methylthiophen-2-yl)acetate |
| PubChem CID | 54165480 |
| Molecular Formula | C11H14O4S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | (2-ethoxy-2-oxoethyl) 2-(3-methylthiophen-2-yl)acetate |
| SMILES | CCOC(=O)COC(=O)Cc1sccc1C |
| InChI | InChI=1S/C11H14O4S/c1-3-14-11(13)7-15-10(12)6-9-8(2)4-5-16-9/h4-5H,3,6-7H2,1-2H3 |
| InChIKey | ORIWBORVHBFSQX-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-ethoxy-2-oxoethyl) 2-(3-methylthiophen-2-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethoxy-2-oxoethyl) 2-(3-methylthiophen-2-yl)acetate?
The IUPAC name of (2-ethoxy-2-oxoethyl) 2-(3-methylthiophen-2-yl)acetate (CID 54165480) is (2-ethoxy-2-oxoethyl) 2-(3-methylthiophen-2-yl)acetate.
What is the SMILES notation for (2-ethoxy-2-oxoethyl) 2-(3-methylthiophen-2-yl)acetate?
The canonical SMILES for (2-ethoxy-2-oxoethyl) 2-(3-methylthiophen-2-yl)acetate is CCOC(=O)COC(=O)Cc1sccc1C.
What is the InChIKey of (2-ethoxy-2-oxoethyl) 2-(3-methylthiophen-2-yl)acetate?
The InChIKey is ORIWBORVHBFSQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O4S/c1-3-14-11(13)7-15-10(12)6-9-8(2)4-5-16-9/h4-5H,3,6-7H2,1-2H3.
What are the key properties of (2-ethoxy-2-oxoethyl) 2-(3-methylthiophen-2-yl)acetate?
(2-ethoxy-2-oxoethyl) 2-(3-methylthiophen-2-yl)acetate has a molecular weight of 242.30 g/mol, XLogP of 1.71, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethoxy-2-oxoethyl) 2-(3-methylthiophen-2-yl)acetate is sourced from PubChem (CID 54165480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).